C12H22NO6P2+ — CID 11544615
[2-[3-(3-methylbutyl)pyridin-1-ium-1-yl]-1-phosphonoethyl]phosphonic acid (PubChem CID 11544615) has the molecular formula C12H22NO6P2+ and a molecular weight of 338.26 g/mol. Its IUPAC name is [2-[3-(3-methylbutyl)pyridin-1-ium-1-yl]-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-[3-(3-methylbutyl)pyridin-1-ium-1-yl]-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 11544615 |
| Molecular Formula | C12H22NO6P2+ |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [2-[3-(3-methylbutyl)pyridin-1-ium-1-yl]-1-phosphonoethyl]phosphonic acid |
| SMILES | CC(C)CCc1ccc[n+](CC(P(=O)(O)O)P(=O)(O)O)c1 |
| InChI | InChI=1S/C12H21NO6P2/c1-10(2)5-6-11-4-3-7-13(8-11)9-12(20(14,15)16)21(17,18)19/h3-4,7-8,10,12H,5-6,9H2,1-2H3,(H3-,14,15,16,17,18,19)/p+1 |
| InChIKey | WEWTZRPQSLIXKX-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 118.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|