C17H33N2O6P2+ — CID 25023877
[2-[3-(decylamino)pyridin-1-ium-1-yl]-1-phosphonoethyl]phosphonic acid (PubChem CID 25023877) has the molecular formula C17H33N2O6P2+ and a molecular weight of 423.41 g/mol. Its IUPAC name is [2-[3-(decylamino)pyridin-1-ium-1-yl]-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-[3-(decylamino)pyridin-1-ium-1-yl]-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 25023877 |
| Molecular Formula | C17H33N2O6P2+ |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | [2-[3-(decylamino)pyridin-1-ium-1-yl]-1-phosphonoethyl]phosphonic acid |
| SMILES | CCCCCCCCCCNc1ccc[n+](CC(P(=O)(O)O)P(=O)(O)O)c1 |
| InChI | InChI=1S/C17H32N2O6P2/c1-2-3-4-5-6-7-8-9-12-18-16-11-10-13-19(14-16)15-17(26(20,21)22)27(23,24)25/h10-11,13-14,17-18H,2-9,12,15H2,1H3,(H3-,20,21,22,23,24,25)/p+1 |
| InChIKey | RVCWWBQTFKGLRM-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 130.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|