C16H30NO6P2+ — CID 145085820
[1-[hydroxy(methoxy)phosphanyl]-2-(3-octoxypyridin-1-ium-1-yl)ethyl]phosphonic acid (PubChem CID 145085820) has the molecular formula C16H30NO6P2+ and a molecular weight of 394.37 g/mol. Its IUPAC name is [1-[hydroxy(methoxy)phosphanyl]-2-(3-octoxypyridin-1-ium-1-yl)ethyl]phosphonic acid.
| Compound Name | [1-[hydroxy(methoxy)phosphanyl]-2-(3-octoxypyridin-1-ium-1-yl)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 145085820 |
| Molecular Formula | C16H30NO6P2+ |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [1-[hydroxy(methoxy)phosphanyl]-2-(3-octoxypyridin-1-ium-1-yl)ethyl]phosphonic acid |
| SMILES | CCCCCCCCOc1ccc[n+](CC(P(O)OC)P(=O)(O)O)c1 |
| InChI | InChI=1S/C16H29NO6P2/c1-3-4-5-6-7-8-12-23-15-10-9-11-17(13-15)14-16(24(18)22-2)25(19,20)21/h9-11,13,16,18H,3-8,12,14H2,1-2H3,(H-,19,20,21)/p+1 |
| InChIKey | VXIFJZSTVRPJFN-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|