C17H32N2O6P2 — CID 25023876
[2-[3-(decylamino)pyridin-1-ium-1-yl]-1-phosphonoethyl]-hydroxyphosphinate (PubChem CID 25023876) has the molecular formula C17H32N2O6P2 and a molecular weight of 422.40 g/mol. Its IUPAC name is [2-[3-(decylamino)pyridin-1-ium-1-yl]-1-phosphonoethyl]-hydroxyphosphinate.
| Compound Name | [2-[3-(decylamino)pyridin-1-ium-1-yl]-1-phosphonoethyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 25023876 |
| Molecular Formula | C17H32N2O6P2 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [2-[3-(decylamino)pyridin-1-ium-1-yl]-1-phosphonoethyl]-hydroxyphosphinate |
| SMILES | CCCCCCCCCCNc1ccc[n+](CC(P(=O)([O-])O)P(=O)(O)O)c1 |
| InChI | InChI=1S/C17H32N2O6P2/c1-2-3-4-5-6-7-8-9-12-18-16-11-10-13-19(14-16)15-17(26(20,21)22)27(23,24)25/h10-11,13-14,17-18H,2-9,12,15H2,1H3,(H3-,20,21,22,23,24,25) |
| InChIKey | RVCWWBQTFKGLRM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|