C15H18NO6P2+ — CID 59698338
[2-(3-benzoylpyridin-1-ium-1-yl)-1-[hydroxy(methyl)phosphoryl]ethyl]phosphonic acid (PubChem CID 59698338) has the molecular formula C15H18NO6P2+ and a molecular weight of 370.26 g/mol. Its IUPAC name is [2-(3-benzoylpyridin-1-ium-1-yl)-1-[hydroxy(methyl)phosphoryl]ethyl]phosphonic acid.
| Compound Name | [2-(3-benzoylpyridin-1-ium-1-yl)-1-[hydroxy(methyl)phosphoryl]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 59698338 |
| Molecular Formula | C15H18NO6P2+ |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | [2-(3-benzoylpyridin-1-ium-1-yl)-1-[hydroxy(methyl)phosphoryl]ethyl]phosphonic acid |
| SMILES | CP(=O)(O)C(C[n+]1cccc(C(=O)c2ccccc2)c1)P(=O)(O)O |
| InChI | InChI=1S/C15H17NO6P2/c1-23(18,19)14(24(20,21)22)11-16-9-5-8-13(10-16)15(17)12-6-3-2-4-7-12/h2-10,14H,11H2,1H3,(H2-,18,19,20,21,22)/p+1 |
| InChIKey | UNBCENOLHIDLGQ-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|