C17H21N2O+ — CID 788076
1-benzyl-N,N-diethylpyridin-1-ium-3-carboxamide (PubChem CID 788076) has the molecular formula C17H21N2O+ and a molecular weight of 269.37 g/mol. Its IUPAC name is 1-benzyl-N,N-diethylpyridin-1-ium-3-carboxamide.
| Compound Name | 1-benzyl-N,N-diethylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 788076 |
| Molecular Formula | C17H21N2O+ |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 1-benzyl-N,N-diethylpyridin-1-ium-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc[n+](Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H21N2O/c1-3-19(4-2)17(20)16-11-8-12-18(14-16)13-15-9-6-5-7-10-15/h5-12,14H,3-4,13H2,1-2H3/q+1 |
| InChIKey | LPXWVNSVSXHULO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|