C22H24N2O6+2 — CID 5252024
2-[3-[[4-[[1-(2,2-dihydroxyethyl)pyridin-1-ium-3-yl]methoxy]phenoxy]methyl]pyridin-1-ium-1-yl]acetic acid (PubChem CID 5252024) has the molecular formula C22H24N2O6+2 and a molecular weight of 412.44 g/mol. Its IUPAC name is 2-[3-[[4-[[1-(2,2-dihydroxyethyl)pyridin-1-ium-3-yl]methoxy]phenoxy]methyl]pyridin-1-ium-1-yl]acetic acid.
| Compound Name | 2-[3-[[4-[[1-(2,2-dihydroxyethyl)pyridin-1-ium-3-yl]methoxy]phenoxy]methyl]pyridin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 5252024 |
| Molecular Formula | C22H24N2O6+2 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[3-[[4-[[1-(2,2-dihydroxyethyl)pyridin-1-ium-3-yl]methoxy]phenoxy]methyl]pyridin-1-ium-1-yl]acetic acid |
| SMILES | O=C(O)C[n+]1cccc(COc2ccc(OCc3ccc[n+](CC(O)O)c3)cc2)c1 |
| InChI | InChI=1S/C22H23N2O6/c25-21(26)13-23-9-1-3-17(11-23)15-29-19-5-7-20(8-6-19)30-16-18-4-2-10-24(12-18)14-22(27)28/h1-12,21,25-26H,13-16H2/q+1/p+1 |
| InChIKey | QGUXXCHOAQFGCC-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 103.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|