C8H13FNO6P2+ — CID 59698334
[2-(3-fluoropyridin-1-ium-1-yl)-1-hydroxy-1-[hydroxy(methyl)phosphoryl]ethyl]phosphonic acid (PubChem CID 59698334) has the molecular formula C8H13FNO6P2+ and a molecular weight of 300.14 g/mol. Its IUPAC name is [2-(3-fluoropyridin-1-ium-1-yl)-1-hydroxy-1-[hydroxy(methyl)phosphoryl]ethyl]phosphonic acid.
| Compound Name | [2-(3-fluoropyridin-1-ium-1-yl)-1-hydroxy-1-[hydroxy(methyl)phosphoryl]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 59698334 |
| Molecular Formula | C8H13FNO6P2+ |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | [2-(3-fluoropyridin-1-ium-1-yl)-1-hydroxy-1-[hydroxy(methyl)phosphoryl]ethyl]phosphonic acid |
| SMILES | CP(=O)(O)C(O)(C[n+]1cccc(F)c1)P(=O)(O)O |
| InChI | InChI=1S/C8H12FNO6P2/c1-17(12,13)8(11,18(14,15)16)6-10-4-2-3-7(9)5-10/h2-5,11H,6H2,1H3,(H2-,12,13,14,15,16)/p+1 |
| InChIKey | QKWIZOWHTOEXHQ-UHFFFAOYSA-O |
| XLogP | -0.16 |
| TPSA | 118.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|