C9H13ClNO6P — CID 19084782
2-hydroxy-3-(1-methylpyridin-1-ium-3-yl)-2-phosphonopropanoic acid chloride (PubChem CID 19084782) has the molecular formula C9H13ClNO6P and a molecular weight of 297.63 g/mol. Its IUPAC name is 2-hydroxy-3-(1-methylpyridin-1-ium-3-yl)-2-phosphonopropanoic acid chloride.
| Compound Name | 2-hydroxy-3-(1-methylpyridin-1-ium-3-yl)-2-phosphonopropanoic acid chloride |
|---|---|
| PubChem CID | 19084782 |
| Molecular Formula | C9H13ClNO6P |
| Molecular Weight | 297.63 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 2-hydroxy-3-(1-methylpyridin-1-ium-3-yl)-2-phosphonopropanoic acid chloride |
| SMILES | C[n+]1cccc(CC(O)(C(=O)O)P(=O)(O)O)c1.[Cl-] |
| InChI | InChI=1S/C9H12NO6P.ClH/c1-10-4-2-3-7(6-10)5-9(13,8(11)12)17(14,15)16;/h2-4,6,13H,5H2,1H3,(H2-,11,12,14,15,16);1H |
| InChIKey | XUOMWMWEXSQYFN-UHFFFAOYSA-N |
| XLogP | -3.99 |
| TPSA | 118.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.63 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|