C8H13NO6PS+ — CID 67819183
1-hydroxy-2-(1-methylpyridin-1-ium-3-yl)-1-phosphonoethanesulfinic acid (PubChem CID 67819183) has the molecular formula C8H13NO6PS+ and a molecular weight of 282.23 g/mol. Its IUPAC name is 1-hydroxy-2-(1-methylpyridin-1-ium-3-yl)-1-phosphonoethanesulfinic acid.
| Compound Name | 1-hydroxy-2-(1-methylpyridin-1-ium-3-yl)-1-phosphonoethanesulfinic acid |
|---|---|
| PubChem CID | 67819183 |
| Molecular Formula | C8H13NO6PS+ |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 1-hydroxy-2-(1-methylpyridin-1-ium-3-yl)-1-phosphonoethanesulfinic acid |
| SMILES | C[n+]1cccc(CC(O)(S(=O)O)P(=O)(O)O)c1 |
| InChI | InChI=1S/C8H12NO6PS/c1-9-4-2-3-7(6-9)5-8(10,17(14)15)16(11,12)13/h2-4,6,10H,5H2,1H3,(H2-,11,12,13,14,15)/p+1 |
| InChIKey | YWFDUSRAFVVCEU-UHFFFAOYSA-O |
| XLogP | -0.90 |
| TPSA | 118.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|