C13H21NO5P+ — CID 167541661
3-(1-tert-butylpyridin-1-ium-3-yl)-2-hydroxy-2-[hydroxy(methyl)phosphoryl]propanoic acid (PubChem CID 167541661) has the molecular formula C13H21NO5P+ and a molecular weight of 302.29 g/mol. Its IUPAC name is 3-(1-tert-butylpyridin-1-ium-3-yl)-2-hydroxy-2-[hydroxy(methyl)phosphoryl]propanoic acid.
| Compound Name | 3-(1-tert-butylpyridin-1-ium-3-yl)-2-hydroxy-2-[hydroxy(methyl)phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 167541661 |
| Molecular Formula | C13H21NO5P+ |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-(1-tert-butylpyridin-1-ium-3-yl)-2-hydroxy-2-[hydroxy(methyl)phosphoryl]propanoic acid |
| SMILES | CC(C)(C)[n+]1cccc(CC(O)(C(=O)O)P(C)(=O)O)c1 |
| InChI | InChI=1S/C13H20NO5P/c1-12(2,3)14-7-5-6-10(9-14)8-13(17,11(15)16)20(4,18)19/h5-7,9,17H,8H2,1-4H3,(H-,15,16,18,19)/p+1 |
| InChIKey | BGTFJHMNTCSDQD-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|