C10H13ClNO6PS — CID 19084801
2-hydroxy-2-phosphono-3-[1-(2-sulfanylideneethyl)pyridin-1-ium-3-yl]propanoic acid chloride (PubChem CID 19084801) has the molecular formula C10H13ClNO6PS and a molecular weight of 341.71 g/mol. Its IUPAC name is 2-hydroxy-2-phosphono-3-[1-(2-sulfanylideneethyl)pyridin-1-ium-3-yl]propanoic acid chloride.
| Compound Name | 2-hydroxy-2-phosphono-3-[1-(2-sulfanylideneethyl)pyridin-1-ium-3-yl]propanoic acid chloride |
|---|---|
| PubChem CID | 19084801 |
| Molecular Formula | C10H13ClNO6PS |
| Molecular Weight | 341.71 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2-hydroxy-2-phosphono-3-[1-(2-sulfanylideneethyl)pyridin-1-ium-3-yl]propanoic acid chloride |
| SMILES | O=C(O)C(O)(Cc1ccc[n+](CC=S)c1)P(=O)(O)O.[Cl-] |
| InChI | InChI=1S/C10H12NO6PS.ClH/c12-9(13)10(14,18(15,16)17)6-8-2-1-3-11(7-8)4-5-19;/h1-3,5,7,14H,4,6H2,(H2-,12,13,15,16,17);1H |
| InChIKey | CNEXQJZWLAUUAZ-UHFFFAOYSA-N |
| XLogP | -3.53 |
| TPSA | 118.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.71 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|