C3H7O7P — CID 101412434
(2S)-2,3-dihydroxy-2-phosphonopropanoic acid (PubChem CID 101412434) has the molecular formula C3H7O7P and a molecular weight of 186.06 g/mol. Its IUPAC name is (2S)-2,3-dihydroxy-2-phosphonopropanoic acid.
| Compound Name | (2S)-2,3-dihydroxy-2-phosphonopropanoic acid |
|---|---|
| PubChem CID | 101412434 |
| Molecular Formula | C3H7O7P |
| Molecular Weight | 186.06 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | (2S)-2,3-dihydroxy-2-phosphonopropanoic acid |
| SMILES | O=C(O)[C@](O)(CO)P(=O)(O)O |
| InChI | InChI=1S/C3H7O7P/c4-1-3(7,2(5)6)11(8,9)10/h4,7H,1H2,(H,5,6)(H2,8,9,10)/t3-/m0/s1 |
| InChIKey | RVKKEHPFHRUPIR-VKHMYHEASA-N |
| XLogP | -2.07 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.06 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|