C8H17ClNO6PS — CID 19084738
(3-carboxy-3-hydroxy-3-phosphonopropyl)-dimethyl-(2-sulfanylideneethyl)azanium chloride (PubChem CID 19084738) has the molecular formula C8H17ClNO6PS and a molecular weight of 321.72 g/mol. Its IUPAC name is (3-carboxy-3-hydroxy-3-phosphonopropyl)-dimethyl-(2-sulfanylideneethyl)azanium chloride.
| Compound Name | (3-carboxy-3-hydroxy-3-phosphonopropyl)-dimethyl-(2-sulfanylideneethyl)azanium chloride |
|---|---|
| PubChem CID | 19084738 |
| Molecular Formula | C8H17ClNO6PS |
| Molecular Weight | 321.72 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | (3-carboxy-3-hydroxy-3-phosphonopropyl)-dimethyl-(2-sulfanylideneethyl)azanium chloride |
| SMILES | C[N+](C)(CC=S)CCC(O)(C(=O)O)P(=O)(O)O.[Cl-] |
| InChI | InChI=1S/C8H16NO6PS.ClH/c1-9(2,5-6-17)4-3-8(12,7(10)11)16(13,14)15;/h6,12H,3-5H2,1-2H3,(H2-,10,11,13,14,15);1H |
| InChIKey | ZEZWIZPSDOQQMR-UHFFFAOYSA-N |
| XLogP | -3.59 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.72 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|