C10H15ClNO6P — CID 19084745
3-(1-ethylpyridin-1-ium-3-yl)-2-hydroxy-2-phosphonopropanoic acid chloride (PubChem CID 19084745) has the molecular formula C10H15ClNO6P and a molecular weight of 311.66 g/mol. Its IUPAC name is 3-(1-ethylpyridin-1-ium-3-yl)-2-hydroxy-2-phosphonopropanoic acid chloride.
| Compound Name | 3-(1-ethylpyridin-1-ium-3-yl)-2-hydroxy-2-phosphonopropanoic acid chloride |
|---|---|
| PubChem CID | 19084745 |
| Molecular Formula | C10H15ClNO6P |
| Molecular Weight | 311.66 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 3-(1-ethylpyridin-1-ium-3-yl)-2-hydroxy-2-phosphonopropanoic acid chloride |
| SMILES | CC[n+]1cccc(CC(O)(C(=O)O)P(=O)(O)O)c1.[Cl-] |
| InChI | InChI=1S/C10H14NO6P.ClH/c1-2-11-5-3-4-8(7-11)6-10(14,9(12)13)18(15,16)17;/h3-5,7,14H,2,6H2,1H3,(H2-,12,13,15,16,17);1H |
| InChIKey | CIAJWHTXFUFDPO-UHFFFAOYSA-N |
| XLogP | -3.51 |
| TPSA | 118.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.66 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|