C15H17NO5S — CID 139814613
1-ethylpyridin-1-ium-3-carboxylic acid;4-methylbenzenesulfonate (PubChem CID 139814613) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 1-ethylpyridin-1-ium-3-carboxylic acid;4-methylbenzenesulfonate.
| Compound Name | 1-ethylpyridin-1-ium-3-carboxylic acid;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139814613 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-ethylpyridin-1-ium-3-carboxylic acid;4-methylbenzenesulfonate |
| SMILES | CC[n+]1cccc(C(=O)O)c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C8H9NO2.C7H8O3S/c1-2-9-5-3-4-7(6-9)8(10)11;1-6-2-4-7(5-3-6)11(8,9)10/h3-6H,2H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | FDOMYWWHVFNLLN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|