C10H19NO6PS+ — CID 19084840
2-hydroxy-2-phosphono-4-[1-(2-sulfanylideneethyl)pyrrolidin-1-ium-1-yl]butanoic acid (PubChem CID 19084840) has the molecular formula C10H19NO6PS+ and a molecular weight of 312.30 g/mol. Its IUPAC name is 2-hydroxy-2-phosphono-4-[1-(2-sulfanylideneethyl)pyrrolidin-1-ium-1-yl]butanoic acid.
| Compound Name | 2-hydroxy-2-phosphono-4-[1-(2-sulfanylideneethyl)pyrrolidin-1-ium-1-yl]butanoic acid |
|---|---|
| PubChem CID | 19084840 |
| Molecular Formula | C10H19NO6PS+ |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-hydroxy-2-phosphono-4-[1-(2-sulfanylideneethyl)pyrrolidin-1-ium-1-yl]butanoic acid |
| SMILES | O=C(O)C(O)(CC[N+]1(CC=S)CCCC1)P(=O)(O)O |
| InChI | InChI=1S/C10H18NO6PS/c12-9(13)10(14,18(15,16)17)3-6-11(7-8-19)4-1-2-5-11/h8,14H,1-7H2,(H2-,12,13,15,16,17)/p+1 |
| InChIKey | BAMVGBQUEUATLZ-UHFFFAOYSA-O |
| XLogP | -0.06 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|