C10H13N3O7P2 — CID 59822041
hydroxy-[1-hydroxy-2-[3-(1H-imidazol-5-yl)pyridin-1-ium-1-yl]-1-phosphonoethyl]phosphinate (PubChem CID 59822041) has the molecular formula C10H13N3O7P2 and a molecular weight of 349.18 g/mol. Its IUPAC name is hydroxy-[1-hydroxy-2-[3-(1H-imidazol-5-yl)pyridin-1-ium-1-yl]-1-phosphonoethyl]phosphinate.
| Compound Name | hydroxy-[1-hydroxy-2-[3-(1H-imidazol-5-yl)pyridin-1-ium-1-yl]-1-phosphonoethyl]phosphinate |
|---|---|
| PubChem CID | 59822041 |
| Molecular Formula | C10H13N3O7P2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | hydroxy-[1-hydroxy-2-[3-(1H-imidazol-5-yl)pyridin-1-ium-1-yl]-1-phosphonoethyl]phosphinate |
| SMILES | O=P([O-])(O)C(O)(C[n+]1cccc(-c2cnc[nH]2)c1)P(=O)(O)O |
| InChI | InChI=1S/C10H13N3O7P2/c14-10(21(15,16)17,22(18,19)20)6-13-3-1-2-8(5-13)9-4-11-7-12-9/h1-5,7,14H,6H2,(H4-,11,12,15,16,17,18,19,20) |
| InChIKey | LAOMZGKJMSQFFF-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 170.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|