C5H11N2O7P2+ — CID 101429576
[1-hydroxy-1-phosphono-2-(1H-pyrazol-2-ium-2-yl)ethyl]phosphonic acid (PubChem CID 101429576) has the molecular formula C5H11N2O7P2+ and a molecular weight of 273.10 g/mol. Its IUPAC name is [1-hydroxy-1-phosphono-2-(1H-pyrazol-2-ium-2-yl)ethyl]phosphonic acid.
| Compound Name | [1-hydroxy-1-phosphono-2-(1H-pyrazol-2-ium-2-yl)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 101429576 |
| Molecular Formula | C5H11N2O7P2+ |
| Molecular Weight | 273.10 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | [1-hydroxy-1-phosphono-2-(1H-pyrazol-2-ium-2-yl)ethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(O)(C[n+]1ccc[nH]1)P(=O)(O)O |
| InChI | InChI=1S/C5H10N2O7P2/c8-5(15(9,10)11,16(12,13)14)4-7-3-1-2-6-7/h1-3,8H,4H2,(H4,9,10,11,12,13,14)/p+1 |
| InChIKey | INKSSGUAUIBWSI-UHFFFAOYSA-O |
| XLogP | -1.70 |
| TPSA | 154.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.10 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|