C10H21N2O7P2+ — CID 165109866
[2-[3-(2,2-dimethylpropyl)imidazol-3-ium-1-yl]-1-hydroxy-1-phosphonoethyl]phosphonic acid (PubChem CID 165109866) has the molecular formula C10H21N2O7P2+ and a molecular weight of 343.23 g/mol. Its IUPAC name is [2-[3-(2,2-dimethylpropyl)imidazol-3-ium-1-yl]-1-hydroxy-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-[3-(2,2-dimethylpropyl)imidazol-3-ium-1-yl]-1-hydroxy-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 165109866 |
| Molecular Formula | C10H21N2O7P2+ |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | [2-[3-(2,2-dimethylpropyl)imidazol-3-ium-1-yl]-1-hydroxy-1-phosphonoethyl]phosphonic acid |
| SMILES | CC(C)(C)C[n+]1ccn(CC(O)(P(=O)(O)O)P(=O)(O)O)c1 |
| InChI | InChI=1S/C10H20N2O7P2/c1-9(2,3)6-11-4-5-12(8-11)7-10(13,20(14,15)16)21(17,18)19/h4-5,8,13H,6-7H2,1-3H3,(H3-,14,15,16,17,18,19)/p+1 |
| InChIKey | ZTOGZMIGZGURAL-UHFFFAOYSA-O |
| XLogP | -0.18 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|