C10H21N2O7P2+ — CID 71625855
[1-hydroxy-2-(3-pentylimidazol-1-ium-1-yl)-1-phosphonoethyl]phosphonic acid (PubChem CID 71625855) has the molecular formula C10H21N2O7P2+ and a molecular weight of 343.23 g/mol. Its IUPAC name is [1-hydroxy-2-(3-pentylimidazol-1-ium-1-yl)-1-phosphonoethyl]phosphonic acid.
| Compound Name | [1-hydroxy-2-(3-pentylimidazol-1-ium-1-yl)-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 71625855 |
| Molecular Formula | C10H21N2O7P2+ |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | [1-hydroxy-2-(3-pentylimidazol-1-ium-1-yl)-1-phosphonoethyl]phosphonic acid |
| SMILES | CCCCCn1cc[n+](CC(O)(P(=O)(O)O)P(=O)(O)O)c1 |
| InChI | InChI=1S/C10H20N2O7P2/c1-2-3-4-5-11-6-7-12(9-11)8-10(13,20(14,15)16)21(17,18)19/h6-7,9,13H,2-5,8H2,1H3,(H3-,14,15,16,17,18,19)/p+1 |
| InChIKey | AFKPRRPXAKQUAV-UHFFFAOYSA-O |
| XLogP | -0.03 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|