C15H33N2O7P2+3 — CID 117071727
[2-(3-decylimidazol-1-ium-1-yl)-1-hydroxy-1-trihydroxyphosphaniumylethyl]-trihydroxyphosphanium (PubChem CID 117071727) has the molecular formula C15H33N2O7P2+3 and a molecular weight of 415.38 g/mol. Its IUPAC name is [2-(3-decylimidazol-1-ium-1-yl)-1-hydroxy-1-trihydroxyphosphaniumylethyl]-trihydroxyphosphanium.
| Compound Name | [2-(3-decylimidazol-1-ium-1-yl)-1-hydroxy-1-trihydroxyphosphaniumylethyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 117071727 |
| Molecular Formula | C15H33N2O7P2+3 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [2-(3-decylimidazol-1-ium-1-yl)-1-hydroxy-1-trihydroxyphosphaniumylethyl]-trihydroxyphosphanium |
| SMILES | CCCCCCCCCCn1cc[n+](CC(O)([P+](O)(O)O)[P+](O)(O)O)c1 |
| InChI | InChI=1S/C15H33N2O7P2/c1-2-3-4-5-6-7-8-9-10-16-11-12-17(14-16)13-15(18,25(19,20)21)26(22,23)24/h11-12,14,18-24H,2-10,13H2,1H3/q+3 |
| InChIKey | HIZZEONUHBKPET-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 150.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|