C13H26N2O7P2 — CID 137349775
hydroxy-[(1S)-1-hydroxy-2-(3-octylimidazol-1-ium-1-yl)-1-phosphonoethyl]phosphinate (PubChem CID 137349775) has the molecular formula C13H26N2O7P2 and a molecular weight of 384.31 g/mol. Its IUPAC name is hydroxy-[(1S)-1-hydroxy-2-(3-octylimidazol-1-ium-1-yl)-1-phosphonoethyl]phosphinate.
| Compound Name | hydroxy-[(1S)-1-hydroxy-2-(3-octylimidazol-1-ium-1-yl)-1-phosphonoethyl]phosphinate |
|---|---|
| PubChem CID | 137349775 |
| Molecular Formula | C13H26N2O7P2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | hydroxy-[(1S)-1-hydroxy-2-(3-octylimidazol-1-ium-1-yl)-1-phosphonoethyl]phosphinate |
| SMILES | CCCCCCCCn1cc[n+](C[C@](O)(P(=O)([O-])O)P(=O)(O)O)c1 |
| InChI | InChI=1S/C13H26N2O7P2/c1-2-3-4-5-6-7-8-14-9-10-15(12-14)11-13(16,23(17,18)19)24(20,21)22/h9-10,12,16H,2-8,11H2,1H3,(H3-,17,18,19,20,21,22) |
| InChIKey | AZKPHAACXOXPFR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 146.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|