C12H20FO4PSi — CID 174402732
[1-(3-fluorophenyl)-1-hydroxy-3-trimethylsilylpropyl]phosphonic acid (PubChem CID 174402732) has the molecular formula C12H20FO4PSi and a molecular weight of 306.35 g/mol. Its IUPAC name is [1-(3-fluorophenyl)-1-hydroxy-3-trimethylsilylpropyl]phosphonic acid.
| Compound Name | [1-(3-fluorophenyl)-1-hydroxy-3-trimethylsilylpropyl]phosphonic acid |
|---|---|
| PubChem CID | 174402732 |
| Molecular Formula | C12H20FO4PSi |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [1-(3-fluorophenyl)-1-hydroxy-3-trimethylsilylpropyl]phosphonic acid |
| SMILES | C[Si](C)(C)CCC(O)(c1cccc(F)c1)P(=O)(O)O |
| InChI | InChI=1S/C12H20FO4PSi/c1-19(2,3)8-7-12(14,18(15,16)17)10-5-4-6-11(13)9-10/h4-6,9,14H,7-8H2,1-3H3,(H2,15,16,17) |
| InChIKey | GYGARPPAXTWVCP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|