C12H20FO5PSi — CID 91424254
[(3-fluorophenyl)-hydroxymethyl] 2-trimethylsilylethyl hydrogen phosphate (PubChem CID 91424254) has the molecular formula C12H20FO5PSi and a molecular weight of 322.35 g/mol. Its IUPAC name is [(3-fluorophenyl)-hydroxymethyl] 2-trimethylsilylethyl hydrogen phosphate.
| Compound Name | [(3-fluorophenyl)-hydroxymethyl] 2-trimethylsilylethyl hydrogen phosphate |
|---|---|
| PubChem CID | 91424254 |
| Molecular Formula | C12H20FO5PSi |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | [(3-fluorophenyl)-hydroxymethyl] 2-trimethylsilylethyl hydrogen phosphate |
| SMILES | C[Si](C)(C)CCOP(=O)(O)OC(O)c1cccc(F)c1 |
| InChI | InChI=1S/C12H20FO5PSi/c1-20(2,3)8-7-17-19(15,16)18-12(14)10-5-4-6-11(13)9-10/h4-6,9,12,14H,7-8H2,1-3H3,(H,15,16) |
| InChIKey | BHYHCVZNSWSXSR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|