C10H3BrF10 — CID 154685385
1-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethyl)benzene (PubChem CID 154685385) has the molecular formula C10H3BrF10 and a molecular weight of 393.02 g/mol. Its IUPAC name is 1-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethyl)benzene.
| Compound Name | 1-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 154685385 |
| Molecular Formula | C10H3BrF10 |
| Molecular Weight | 393.02 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | 1-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C10H3BrF10/c11-6-2-1-4(3-5(6)8(13,14)15)7(12,9(16,17)18)10(19,20)21/h1-3H |
| InChIKey | XGHGFOYCSFQRON-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.02 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |