C18H15F7N2O — CID 86640288
N-(3-aminophenyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylbenzamide (PubChem CID 86640288) has the molecular formula C18H15F7N2O and a molecular weight of 408.32 g/mol. Its IUPAC name is N-(3-aminophenyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylbenzamide.
| Compound Name | N-(3-aminophenyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 86640288 |
| Molecular Formula | C18H15F7N2O |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-(3-aminophenyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylbenzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1C(=O)Nc1cccc(N)c1 |
| InChI | InChI=1S/C18H15F7N2O/c1-9-6-11(16(19,17(20,21)22)18(23,24)25)7-10(2)14(9)15(28)27-13-5-3-4-12(26)8-13/h3-8H,26H2,1-2H3,(H,27,28) |
| InChIKey | DPBQLKDBFAVZMQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|