C16H15F7N2OS — CID 162252865
1-amino-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]thiophene-1-carboxamide (PubChem CID 162252865) has the molecular formula C16H15F7N2OS and a molecular weight of 416.36 g/mol. Its IUPAC name is 1-amino-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]thiophene-1-carboxamide.
| Compound Name | 1-amino-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]thiophene-1-carboxamide |
|---|---|
| PubChem CID | 162252865 |
| Molecular Formula | C16H15F7N2OS |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 1-amino-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]thiophene-1-carboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)S1(N)C=CC=C1 |
| InChI | InChI=1S/C16H15F7N2OS/c1-9-7-11(14(17,15(18,19)20)16(21,22)23)8-10(2)12(9)25-13(26)27(24)5-3-4-6-27/h3-8H,24H2,1-2H3,(H,25,26) |
| InChIKey | ZYFGDTAOVICVLO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|