C24H11F12IN2O2 — CID 162137381
6-fluoro-N-[2-fluoro-3-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodo-6-(trifluoromethyl)phenyl]acetyl]phenyl]pyridine-3-carboxamide (PubChem CID 162137381) has the molecular formula C24H11F12IN2O2 and a molecular weight of 714.24 g/mol. Its IUPAC name is 6-fluoro-N-[2-fluoro-3-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodo-6-(trifluoromethyl)phenyl]acetyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-[2-fluoro-3-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodo-6-(trifluoromethyl)phenyl]acetyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162137381 |
| Molecular Formula | C24H11F12IN2O2 |
| Molecular Weight | 714.24 g/mol |
| Exact Mass | 713.97 |
| IUPAC Name | 6-fluoro-N-[2-fluoro-3-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodo-6-(trifluoromethyl)phenyl]acetyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)Cc2c(I)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1F)c1ccc(F)nc1 |
| InChI | InChI=1S/C24H11F12IN2O2/c25-18-5-4-10(9-38-18)20(41)39-16-3-1-2-12(19(16)26)17(40)8-13-14(22(28,29)30)6-11(7-15(13)37)21(27,23(31,32)33)24(34,35)36/h1-7,9H,8H2,(H,39,41) |
| InChIKey | ZJLVPDWBYCKYKF-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.24 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|