C18H12BrF9N2O2 — CID 145151900
3-amino-N-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-methylbenzamide (PubChem CID 145151900) has the molecular formula C18H12BrF9N2O2 and a molecular weight of 539.19 g/mol. Its IUPAC name is 3-amino-N-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-methylbenzamide.
| Compound Name | 3-amino-N-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 145151900 |
| Molecular Formula | C18H12BrF9N2O2 |
| Molecular Weight | 539.19 g/mol |
| Exact Mass | 537.99 |
| IUPAC Name | 3-amino-N-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1cccc(N)c1)c1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1OC(F)F |
| InChI | InChI=1S/C18H12BrF9N2O2/c1-30(14(31)8-3-2-4-10(29)5-8)13-11(19)6-9(7-12(13)32-15(20)21)16(22,17(23,24)25)18(26,27)28/h2-7,15H,29H2,1H3 |
| InChIKey | QLEZTDGEFLOULK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.19 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|