C20H11BrCl2F16N2O2 — CID 158642644
2-bromo-4-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)-6-(difluoromethoxy)aniline;4-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-(difluoromethoxy)aniline (PubChem CID 158642644) has the molecular formula C20H11BrCl2F16N2O2 and a molecular weight of 766.10 g/mol. Its IUPAC name is 2-bromo-4-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)-6-(difluoromethoxy)aniline;4-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-(difluoromethoxy)aniline.
| Compound Name | 2-bromo-4-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)-6-(difluoromethoxy)aniline;4-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-(difluoromethoxy)aniline |
|---|---|
| PubChem CID | 158642644 |
| Molecular Formula | C20H11BrCl2F16N2O2 |
| Molecular Weight | 766.10 g/mol |
| Exact Mass | 763.91 |
| IUPAC Name | 2-bromo-4-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)-6-(difluoromethoxy)aniline;4-(1-chloro-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-(difluoromethoxy)aniline |
| SMILES | Nc1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)Cl)cc1OC(F)F.Nc1ccc(C(F)(C(F)(F)F)C(F)(F)Cl)cc1OC(F)F |
| InChI | InChI=1S/C10H5BrClF8NO.C10H6ClF8NO/c11-4-1-3(2-5(6(4)21)22-7(13)14)8(15,9(12,16)17)10(18,19)20;11-9(15,16)8(14,10(17,18)19)4-1-2-5(20)6(3-4)21-7(12)13/h1-2,7H,21H2;1-3,7H,20H2 |
| InChIKey | IAOSEPJTUKRWQW-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.10 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|