C11H8BrF8NO — CID 129018154
4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-(difluoromethoxy)-6-methylaniline (PubChem CID 129018154) has the molecular formula C11H8BrF8NO and a molecular weight of 402.08 g/mol. Its IUPAC name is 4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-(difluoromethoxy)-6-methylaniline.
| Compound Name | 4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-(difluoromethoxy)-6-methylaniline |
|---|---|
| PubChem CID | 129018154 |
| Molecular Formula | C11H8BrF8NO |
| Molecular Weight | 402.08 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-(difluoromethoxy)-6-methylaniline |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)Br)cc(OC(F)F)c1N |
| InChI | InChI=1S/C11H8BrF8NO/c1-4-2-5(3-6(7(4)21)22-8(13)14)9(15,10(12,16)17)11(18,19)20/h2-3,8H,21H2,1H3 |
| InChIKey | VTDHYALIVNSNEZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.08 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|