C9H12ClF2NO — CID 117071645
4-(difluoromethoxy)-2,6-dimethylaniline;hydrochloride (PubChem CID 117071645) has the molecular formula C9H12ClF2NO and a molecular weight of 223.65 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2,6-dimethylaniline;hydrochloride.
| Compound Name | 4-(difluoromethoxy)-2,6-dimethylaniline;hydrochloride |
|---|---|
| PubChem CID | 117071645 |
| Molecular Formula | C9H12ClF2NO |
| Molecular Weight | 223.65 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4-(difluoromethoxy)-2,6-dimethylaniline;hydrochloride |
| SMILES | Cc1cc(OC(F)F)cc(C)c1N.Cl |
| InChI | InChI=1S/C9H11F2NO.ClH/c1-5-3-7(13-9(10)11)4-6(2)8(5)12;/h3-4,9H,12H2,1-2H3;1H |
| InChIKey | FJLKCTAGHREPPT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|