C11H16F2O — CID 144663718
1-(difluoromethoxy)-3,5-dimethylbenzene;ethane (PubChem CID 144663718) has the molecular formula C11H16F2O and a molecular weight of 202.24 g/mol. Its IUPAC name is 1-(difluoromethoxy)-3,5-dimethylbenzene;ethane.
| Compound Name | 1-(difluoromethoxy)-3,5-dimethylbenzene;ethane |
|---|---|
| PubChem CID | 144663718 |
| Molecular Formula | C11H16F2O |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-(difluoromethoxy)-3,5-dimethylbenzene;ethane |
| SMILES | CC.Cc1cc(C)cc(OC(F)F)c1 |
| InChI | InChI=1S/C9H10F2O.C2H6/c1-6-3-7(2)5-8(4-6)12-9(10)11;1-2/h3-5,9H,1-2H3;1-2H3 |
| InChIKey | UTNZFOHTWWNTNQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |