C10H10F2O2 — CID 131524664
4-(difluoromethoxy)-2,6-dimethylbenzaldehyde (PubChem CID 131524664) has the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2,6-dimethylbenzaldehyde.
| Compound Name | 4-(difluoromethoxy)-2,6-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 131524664 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4-(difluoromethoxy)-2,6-dimethylbenzaldehyde |
| SMILES | Cc1cc(OC(F)F)cc(C)c1C=O |
| InChI | InChI=1S/C10H10F2O2/c1-6-3-8(14-10(11)12)4-7(2)9(6)5-13/h3-5,10H,1-2H3 |
| InChIKey | QBOAOOPKTDNEGD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|