C9H8F4O2 — CID 71140593
1,4-bis(difluoromethoxy)-2-methylbenzene (PubChem CID 71140593) has the molecular formula C9H8F4O2 and a molecular weight of 224.15 g/mol. Its IUPAC name is 1,4-bis(difluoromethoxy)-2-methylbenzene.
| Compound Name | 1,4-bis(difluoromethoxy)-2-methylbenzene |
|---|---|
| PubChem CID | 71140593 |
| Molecular Formula | C9H8F4O2 |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1,4-bis(difluoromethoxy)-2-methylbenzene |
| SMILES | Cc1cc(OC(F)F)ccc1OC(F)F |
| InChI | InChI=1S/C9H8F4O2/c1-5-4-6(14-8(10)11)2-3-7(5)15-9(12)13/h2-4,8-9H,1H3 |
| InChIKey | UFLJTBKOXWAEHS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |