C12H12F2OS — CID 153339147
2-[4-(difluoromethoxy)-3-methylphenyl]ethynyl-methyl-methylidene-λ4-sulfane (PubChem CID 153339147) has the molecular formula C12H12F2OS and a molecular weight of 242.29 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)-3-methylphenyl]ethynyl-methyl-methylidene-λ4-sulfane.
| Compound Name | 2-[4-(difluoromethoxy)-3-methylphenyl]ethynyl-methyl-methylidene-λ4-sulfane |
|---|---|
| PubChem CID | 153339147 |
| Molecular Formula | C12H12F2OS |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-[4-(difluoromethoxy)-3-methylphenyl]ethynyl-methyl-methylidene-λ4-sulfane |
| SMILES | C=S(C)C#Cc1ccc(OC(F)F)c(C)c1 |
| InChI | InChI=1S/C12H12F2OS/c1-9-8-10(6-7-16(2)3)4-5-11(9)15-12(13)14/h4-5,8,12H,2H2,1,3H3 |
| InChIKey | VASUJPPUWVXFFK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|