About 5-(difluoromethoxy)-2,3-dimethylpyridine
5-(difluoromethoxy)-2,3-dimethylpyridine (PubChem CID 130882921) has the molecular formula C8H9F2NO
and a molecular weight of 173.16 g/mol. Its IUPAC name is 5-(difluoromethoxy)-2,3-dimethylpyridine.
Molecular Properties
| Compound Name | 5-(difluoromethoxy)-2,3-dimethylpyridine |
| PubChem CID | 130882921 |
| Molecular Formula | C8H9F2NO |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 5-(difluoromethoxy)-2,3-dimethylpyridine |
| SMILES | Cc1cc(OC(F)F)cnc1C |
| InChI | InChI=1S/C8H9F2NO/c1-5-3-7(12-8(9)10)4-11-6(5)2/h3-4,8H,1-2H3 |
| InChIKey | QUTSDMUSPAGKLF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(difluoromethoxy)-2,3-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethoxy)-2,3-dimethylpyridine?
The IUPAC name of 5-(difluoromethoxy)-2,3-dimethylpyridine (CID 130882921) is 5-(difluoromethoxy)-2,3-dimethylpyridine.
What is the SMILES notation for 5-(difluoromethoxy)-2,3-dimethylpyridine?
The canonical SMILES for 5-(difluoromethoxy)-2,3-dimethylpyridine is Cc1cc(OC(F)F)cnc1C.
What is the InChIKey of 5-(difluoromethoxy)-2,3-dimethylpyridine?
The InChIKey is QUTSDMUSPAGKLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2NO/c1-5-3-7(12-8(9)10)4-11-6(5)2/h3-4,8H,1-2H3.
What are the key properties of 5-(difluoromethoxy)-2,3-dimethylpyridine?
5-(difluoromethoxy)-2,3-dimethylpyridine has a molecular weight of 173.16 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethoxy)-2,3-dimethylpyridine is sourced from PubChem (CID 130882921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).