C11H6F11NO — CID 87192436
2-(difluoromethoxy)-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)aniline (PubChem CID 87192436) has the molecular formula C11H6F11NO and a molecular weight of 377.15 g/mol. Its IUPAC name is 2-(difluoromethoxy)-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)aniline.
| Compound Name | 2-(difluoromethoxy)-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)aniline |
|---|---|
| PubChem CID | 87192436 |
| Molecular Formula | C11H6F11NO |
| Molecular Weight | 377.15 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2-(difluoromethoxy)-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)aniline |
| SMILES | Nc1ccc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc1OC(F)F |
| InChI | InChI=1S/C11H6F11NO/c12-7(13)24-6-3-4(1-2-5(6)23)8(14,10(17,18)19)9(15,16)11(20,21)22/h1-3,7H,23H2 |
| InChIKey | QXACREXPILIIBN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.15 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|