C10H4BrClF9NO — CID 89106091
4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-chloro-6-(trifluoromethoxy)aniline (PubChem CID 89106091) has the molecular formula C10H4BrClF9NO and a molecular weight of 440.49 g/mol. Its IUPAC name is 4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-chloro-6-(trifluoromethoxy)aniline.
| Compound Name | 4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-chloro-6-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 89106091 |
| Molecular Formula | C10H4BrClF9NO |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 438.90 |
| IUPAC Name | 4-(1-bromo-1,1,2,3,3,3-hexafluoropropan-2-yl)-2-chloro-6-(trifluoromethoxy)aniline |
| SMILES | Nc1c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C10H4BrClF9NO/c11-8(14,15)7(13,9(16,17)18)3-1-4(12)6(22)5(2-3)23-10(19,20)21/h1-2H,22H2 |
| InChIKey | JYCUOCUMLUUHCW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|