C27H28F7N5O3 — CID 87221736
tert-butyl-[[5-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]-2-(1,2,4-triazol-1-yl)phenyl]methyl]carbamic acid (PubChem CID 87221736) has the molecular formula C27H28F7N5O3 and a molecular weight of 603.54 g/mol. Its IUPAC name is tert-butyl-[[5-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]-2-(1,2,4-triazol-1-yl)phenyl]methyl]carbamic acid.
| Compound Name | tert-butyl-[[5-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]-2-(1,2,4-triazol-1-yl)phenyl]methyl]carbamic acid |
|---|---|
| PubChem CID | 87221736 |
| Molecular Formula | C27H28F7N5O3 |
| Molecular Weight | 603.54 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | tert-butyl-[[5-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]-2-(1,2,4-triazol-1-yl)phenyl]methyl]carbamic acid |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1ccc(-n2cncn2)c(CN(C(=O)O)C(C)(C)C)c1 |
| InChI | InChI=1S/C27H28F7N5O3/c1-6-16-11-19(25(28,26(29,30)31)27(32,33)34)9-15(2)21(16)37-22(40)17-7-8-20(39-14-35-13-36-39)18(10-17)12-38(23(41)42)24(3,4)5/h7-11,13-14H,6,12H2,1-5H3,(H,37,40)(H,41,42) |
| InChIKey | ZJNIXBBWXPPHQC-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.54 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |