C23H11BrClF11N4O2 — CID 88941866
N-[6-amino-3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-6-chloropyridine-3-carboxamide (PubChem CID 88941866) has the molecular formula C23H11BrClF11N4O2 and a molecular weight of 699.70 g/mol. Its IUPAC name is N-[6-amino-3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-6-chloropyridine-3-carboxamide.
| Compound Name | N-[6-amino-3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-6-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 88941866 |
| Molecular Formula | C23H11BrClF11N4O2 |
| Molecular Weight | 699.70 g/mol |
| Exact Mass | 697.96 |
| IUPAC Name | N-[6-amino-3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-6-chloropyridine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c(F)c1NC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C23H11BrClF11N4O2/c24-12-6-9(20(27,22(31,32)33)23(34,35)36)5-11(21(28,29)30)16(12)39-19(42)10-2-3-13(37)17(15(10)26)40-18(41)8-1-4-14(25)38-7-8/h1-7H,37H2,(H,39,42)(H,40,41) |
| InChIKey | YFQDDDUBSWYLPH-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.70 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|