C15H7ClF3NO4 — CID 146573647
3-[(2,2-difluoro-1,3-benzodioxole-5-carbonyl)amino]-2-fluorobenzoyl chloride (PubChem CID 146573647) has the molecular formula C15H7ClF3NO4 and a molecular weight of 357.67 g/mol. Its IUPAC name is 3-[(2,2-difluoro-1,3-benzodioxole-5-carbonyl)amino]-2-fluorobenzoyl chloride.
| Compound Name | 3-[(2,2-difluoro-1,3-benzodioxole-5-carbonyl)amino]-2-fluorobenzoyl chloride |
|---|---|
| PubChem CID | 146573647 |
| Molecular Formula | C15H7ClF3NO4 |
| Molecular Weight | 357.67 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 3-[(2,2-difluoro-1,3-benzodioxole-5-carbonyl)amino]-2-fluorobenzoyl chloride |
| SMILES | O=C(Nc1cccc(C(=O)Cl)c1F)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C15H7ClF3NO4/c16-13(21)8-2-1-3-9(12(8)17)20-14(22)7-4-5-10-11(6-7)24-15(18,19)23-10/h1-6H,(H,20,22) |
| InChIKey | FVODXTRFHJRYQS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|