C25H12F13IN2O2 — CID 87288746
2-fluoro-N-[3-[[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]phenyl]benzamide (PubChem CID 87288746) has the molecular formula C25H12F13IN2O2 and a molecular weight of 746.26 g/mol. Its IUPAC name is 2-fluoro-N-[3-[[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[3-[[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 87288746 |
| Molecular Formula | C25H12F13IN2O2 |
| Molecular Weight | 746.26 g/mol |
| Exact Mass | 745.97 |
| IUPAC Name | 2-fluoro-N-[3-[[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1c(I)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc1C(F)(F)F)c1cccc(NC(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C25H12F13IN2O2/c26-16-7-2-1-6-14(16)20(43)40-13-5-3-4-11(8-13)19(42)41-18-15(22(28,29)30)9-12(10-17(18)39)21(27,24(33,34)35)23(31,32)25(36,37)38/h1-10H,(H,40,43)(H,41,42) |
| InChIKey | DGPLGUXYNGBCOX-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.26 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|