C18H8BrF12NO — CID 154036830
2-[2-bromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]benzamide (PubChem CID 154036830) has the molecular formula C18H8BrF12NO and a molecular weight of 562.15 g/mol. Its IUPAC name is 2-[2-bromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[2-bromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 154036830 |
| Molecular Formula | C18H8BrF12NO |
| Molecular Weight | 562.15 g/mol |
| Exact Mass | 560.96 |
| IUPAC Name | 2-[2-bromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]benzamide |
| SMILES | NC(=O)c1ccccc1-c1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C18H8BrF12NO/c19-11-6-7(14(20,17(26,27)28)16(24,25)18(29,30)31)5-10(15(21,22)23)12(11)8-3-1-2-4-9(8)13(32)33/h1-6H,(H2,32,33) |
| InChIKey | XSBURDWYMZARIU-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.15 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|