C16H6Br2F10 — CID 173054680
1,5-dibromo-2-(2-fluorophenyl)-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene (PubChem CID 173054680) has the molecular formula C16H6Br2F10 and a molecular weight of 548.01 g/mol. Its IUPAC name is 1,5-dibromo-2-(2-fluorophenyl)-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene.
| Compound Name | 1,5-dibromo-2-(2-fluorophenyl)-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene |
|---|---|
| PubChem CID | 173054680 |
| Molecular Formula | C16H6Br2F10 |
| Molecular Weight | 548.01 g/mol |
| Exact Mass | 545.87 |
| IUPAC Name | 1,5-dibromo-2-(2-fluorophenyl)-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene |
| SMILES | Fc1ccccc1-c1c(Br)cc(Br)cc1C(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H6Br2F10/c17-7-5-9(12(10(18)6-7)8-3-1-2-4-11(8)19)13(20,15(23,24)25)14(21,22)16(26,27)28/h1-6H |
| InChIKey | SXOMGVNAWUAEMF-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.01 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|