C16H6Br2F10S — CID 173059734
1,5-dibromo-2-(2-fluorophenyl)-3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyl)benzene (PubChem CID 173059734) has the molecular formula C16H6Br2F10S and a molecular weight of 580.08 g/mol. Its IUPAC name is 1,5-dibromo-2-(2-fluorophenyl)-3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyl)benzene.
| Compound Name | 1,5-dibromo-2-(2-fluorophenyl)-3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyl)benzene |
|---|---|
| PubChem CID | 173059734 |
| Molecular Formula | C16H6Br2F10S |
| Molecular Weight | 580.08 g/mol |
| Exact Mass | 577.84 |
| IUPAC Name | 1,5-dibromo-2-(2-fluorophenyl)-3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyl)benzene |
| SMILES | Fc1ccccc1-c1c(Br)cc(Br)cc1SC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H6Br2F10S/c17-7-5-9(18)12(8-3-1-2-4-10(8)19)11(6-7)29-16(27,28)14(22,23)13(20,21)15(24,25)26/h1-6H |
| InChIKey | JKFLGNMYIWDTNP-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.08 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|