C15H6Br3F7S — CID 173059724
1,5-dibromo-2-(2-bromophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)benzene (PubChem CID 173059724) has the molecular formula C15H6Br3F7S and a molecular weight of 590.98 g/mol. Its IUPAC name is 1,5-dibromo-2-(2-bromophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)benzene.
| Compound Name | 1,5-dibromo-2-(2-bromophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)benzene |
|---|---|
| PubChem CID | 173059724 |
| Molecular Formula | C15H6Br3F7S |
| Molecular Weight | 590.98 g/mol |
| Exact Mass | 587.76 |
| IUPAC Name | 1,5-dibromo-2-(2-bromophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)Sc1cc(Br)cc(Br)c1-c1ccccc1Br |
| InChI | InChI=1S/C15H6Br3F7S/c16-7-5-10(18)12(8-3-1-2-4-9(8)17)11(6-7)26-15(24,25)13(19,20)14(21,22)23/h1-6H |
| InChIKey | PVQYAVBRBLMSCZ-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.98 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|