C15H6Br2F7NO3S — CID 173059346
1,5-dibromo-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)-2-(2-nitrophenyl)benzene (PubChem CID 173059346) has the molecular formula C15H6Br2F7NO3S and a molecular weight of 573.08 g/mol. Its IUPAC name is 1,5-dibromo-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)-2-(2-nitrophenyl)benzene.
| Compound Name | 1,5-dibromo-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)-2-(2-nitrophenyl)benzene |
|---|---|
| PubChem CID | 173059346 |
| Molecular Formula | C15H6Br2F7NO3S |
| Molecular Weight | 573.08 g/mol |
| Exact Mass | 570.83 |
| IUPAC Name | 1,5-dibromo-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)-2-(2-nitrophenyl)benzene |
| SMILES | O=[N+]([O-])c1ccccc1-c1c(Br)cc(Br)cc1S(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H6Br2F7NO3S/c16-7-5-9(17)12(8-3-1-2-4-10(8)25(26)27)11(6-7)29(28)15(23,24)13(18,19)14(20,21)22/h1-6H |
| InChIKey | CKQXVJKXRZMBOF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.08 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|