C18H12F9NO2 — CID 173059761
1,5-dimethyl-2-(2-nitrophenyl)-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene (PubChem CID 173059761) has the molecular formula C18H12F9NO2 and a molecular weight of 445.28 g/mol. Its IUPAC name is 1,5-dimethyl-2-(2-nitrophenyl)-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene.
| Compound Name | 1,5-dimethyl-2-(2-nitrophenyl)-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene |
|---|---|
| PubChem CID | 173059761 |
| Molecular Formula | C18H12F9NO2 |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 1,5-dimethyl-2-(2-nitrophenyl)-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene |
| SMILES | Cc1cc(C)c(-c2ccccc2[N+](=O)[O-])c(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12F9NO2/c1-9-7-10(2)14(11-5-3-4-6-13(11)28(29)30)12(8-9)15(19,17(22,23)24)16(20,21)18(25,26)27/h3-8H,1-2H3 |
| InChIKey | BOFPLGLTHYRZIJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|